6-ROX is the other purified single isomer of 5(6)-ROX. It is preferred for some complicated biological applications where reproducibility is more critical since the minor positional difference between 5-ROX and 6-ROX might significantly affect some biological properties of the underlying conjugates. 6-ROX is predominantly used to label nucleotides and for DNA sequencing.
| Product Name: | 6-ROX |
| Synonyms: | 6-Carboxy-X-rhodamine |
| CAS Number: | 194785-18-7 |
| Molecular Formula: | C33H30N2O5 |
| Molecular Weight: | 534.612 |
| SMILES: | OC(=O)C1=CC=C(C([O-])=O)C(=C1)C1=C2C=C3CCC[N+]4=C3C(CCC4)=C2OC2=C3CCCN4CCCC(C=C12)=C34 |
| Purity (HPLC): | ≥ 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |